C18H18F3N3OS — CID 156804931
ethane;N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-2-(trifluoromethyl)benzamide (PubChem CID 156804931) has the molecular formula C18H18F3N3OS and a molecular weight of 381.42 g/mol. Its IUPAC name is ethane;N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-2-(trifluoromethyl)benzamide.
| Compound Name | ethane;N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 156804931 |
| Molecular Formula | C18H18F3N3OS |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | ethane;N-[(3-thiophen-2-yl-1H-pyrazol-5-yl)methyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC.O=C(NCc1cc(-c2cccs2)n[nH]1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3OS.C2H6/c17-16(18,19)12-5-2-1-4-11(12)15(23)20-9-10-8-13(22-21-10)14-6-3-7-24-14;1-2/h1-8H,9H2,(H,20,23)(H,21,22);1-2H3 |
| InChIKey | LKWMKPQIDONCFS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |