About 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one
3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one (PubChem CID 156805523) has the molecular formula C21H19Cl2N5O
and a molecular weight of 428.32 g/mol. Its IUPAC name is 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one.
Molecular Properties
| Compound Name | 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one |
| PubChem CID | 156805523 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one |
| SMILES | Nc1c(C2CCN(c3ccc(Cl)cc3)CC2)[nH]n2c(=O)c3cc(Cl)ccc3nc12 |
| InChI | InChI=1S/C21H19Cl2N5O/c22-13-1-4-15(5-2-13)27-9-7-12(8-10-27)19-18(24)20-25-17-6-3-14(23)11-16(17)21(29)28(20)26-19/h1-6,11-12,26H,7-10,24H2 |
| InChIKey | CVRKFVLRNGTCFM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one?
The IUPAC name of 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one (CID 156805523) is 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one.
What is the SMILES notation for 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one?
The canonical SMILES for 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one is Nc1c(C2CCN(c3ccc(Cl)cc3)CC2)[nH]n2c(=O)c3cc(Cl)ccc3nc12.
What is the InChIKey of 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one?
The InChIKey is CVRKFVLRNGTCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2N5O/c22-13-1-4-15(5-2-13)27-9-7-12(8-10-27)19-18(24)20-25-17-6-3-14(23)11-16(17)21(29)28(20)26-19/h1-6,11-12,26H,7-10,24H2.
What are the key properties of 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one?
3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one has a molecular weight of 428.32 g/mol, XLogP of 4.45, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-chloro-2-[1-(4-chlorophenyl)piperidin-4-yl]-1H-pyrazolo[5,1-b]quinazolin-9-one is sourced from PubChem (CID 156805523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).