C10H11F10NO — CID 156806396
1-[1,1,2,2,4,4,4-heptafluoro-3-methoxy-3-(trifluoromethyl)butyl]pyrrolidine (PubChem CID 156806396) has the molecular formula C10H11F10NO and a molecular weight of 351.18 g/mol. Its IUPAC name is 1-[1,1,2,2,4,4,4-heptafluoro-3-methoxy-3-(trifluoromethyl)butyl]pyrrolidine.
| Compound Name | 1-[1,1,2,2,4,4,4-heptafluoro-3-methoxy-3-(trifluoromethyl)butyl]pyrrolidine |
|---|---|
| PubChem CID | 156806396 |
| Molecular Formula | C10H11F10NO |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-[1,1,2,2,4,4,4-heptafluoro-3-methoxy-3-(trifluoromethyl)butyl]pyrrolidine |
| SMILES | COC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C10H11F10NO/c1-22-6(8(13,14)15,9(16,17)18)7(11,12)10(19,20)21-4-2-3-5-21/h2-5H2,1H3 |
| InChIKey | UCXFTVMHHLGNRW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|