C17H27FO2S — CID 156806455
3-[(5Z,8Z,11Z)-3-fluorotetradeca-5,8,11-trienyl]sulfanylpropanoic acid (PubChem CID 156806455) has the molecular formula C17H27FO2S and a molecular weight of 314.47 g/mol. Its IUPAC name is 3-[(5Z,8Z,11Z)-3-fluorotetradeca-5,8,11-trienyl]sulfanylpropanoic acid.
| Compound Name | 3-[(5Z,8Z,11Z)-3-fluorotetradeca-5,8,11-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 156806455 |
| Molecular Formula | C17H27FO2S |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-[(5Z,8Z,11Z)-3-fluorotetradeca-5,8,11-trienyl]sulfanylpropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(F)CCSCCC(=O)O |
| InChI | InChI=1S/C17H27FO2S/c1-2-3-4-5-6-7-8-9-10-11-16(18)12-14-21-15-13-17(19)20/h3-4,6-7,9-10,16H,2,5,8,11-15H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
| InChIKey | OCLIEEMEUJQVOT-PDBXOOCHSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|