About (E)-4-chloro-N,N-diethylbut-2-en-1-amine
(E)-4-chloro-N,N-diethylbut-2-en-1-amine (PubChem CID 15680719) has the molecular formula C8H16ClN
and a molecular weight of 161.68 g/mol. Its IUPAC name is (E)-4-chloro-N,N-diethylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-chloro-N,N-diethylbut-2-en-1-amine |
| PubChem CID | 15680719 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (E)-4-chloro-N,N-diethylbut-2-en-1-amine |
| SMILES | CCN(CC)C/C=C/CCl |
| InChI | InChI=1S/C8H16ClN/c1-3-10(4-2)8-6-5-7-9/h5-6H,3-4,7-8H2,1-2H3/b6-5+ |
| InChIKey | CZVKTKAZOWERON-AATRIKPKSA-N |
| XLogP | 2.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-chloro-N,N-diethylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-chloro-N,N-diethylbut-2-en-1-amine?
The IUPAC name of (E)-4-chloro-N,N-diethylbut-2-en-1-amine (CID 15680719) is (E)-4-chloro-N,N-diethylbut-2-en-1-amine.
What is the SMILES notation for (E)-4-chloro-N,N-diethylbut-2-en-1-amine?
The canonical SMILES for (E)-4-chloro-N,N-diethylbut-2-en-1-amine is CCN(CC)C/C=C/CCl.
What is the InChIKey of (E)-4-chloro-N,N-diethylbut-2-en-1-amine?
The InChIKey is CZVKTKAZOWERON-AATRIKPKSA-N. The full InChI is InChI=1S/C8H16ClN/c1-3-10(4-2)8-6-5-7-9/h5-6H,3-4,7-8H2,1-2H3/b6-5+.
What are the key properties of (E)-4-chloro-N,N-diethylbut-2-en-1-amine?
(E)-4-chloro-N,N-diethylbut-2-en-1-amine has a molecular weight of 161.68 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-chloro-N,N-diethylbut-2-en-1-amine is sourced from PubChem (CID 15680719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).