C27H22N2O2S — CID 156809411
5-[[4-phenyl-6-(2-phenylethyl)quinolin-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 156809411) has the molecular formula C27H22N2O2S and a molecular weight of 438.55 g/mol. Its IUPAC name is 5-[[4-phenyl-6-(2-phenylethyl)quinolin-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-phenyl-6-(2-phenylethyl)quinolin-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 156809411 |
| Molecular Formula | C27H22N2O2S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 5-[[4-phenyl-6-(2-phenylethyl)quinolin-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2cc(-c3ccccc3)c3cc(CCc4ccccc4)ccc3n2)S1 |
| InChI | InChI=1S/C27H22N2O2S/c30-26-25(32-27(31)29-26)17-21-16-22(20-9-5-2-6-10-20)23-15-19(13-14-24(23)28-21)12-11-18-7-3-1-4-8-18/h1-10,13-16,25H,11-12,17H2,(H,29,30,31) |
| InChIKey | ICGAHWMWTUMFCC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|