About 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium
4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium (PubChem CID 156809665) has the molecular formula C5H7N2Rh-
and a molecular weight of 198.03 g/mol. Its IUPAC name is 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium |
| PubChem CID | 156809665 |
| Molecular Formula | C5H7N2Rh- |
| Molecular Weight | 198.03 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium |
| SMILES | Cc1n[c-][nH]c1C.[Rh] |
| InChI | InChI=1S/C5H7N2.Rh/c1-4-5(2)7-3-6-4;/h1-2H3,(H,6,7);/q-1; |
| InChIKey | BCTMAIBNOLTWEQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.03 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium?
The IUPAC name of 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium (CID 156809665) is 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium.
What is the SMILES notation for 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium?
The canonical SMILES for 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium is Cc1n[c-][nH]c1C.[Rh].
What is the InChIKey of 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium?
The InChIKey is BCTMAIBNOLTWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N2.Rh/c1-4-5(2)7-3-6-4;/h1-2H3,(H,6,7);/q-1;.
What are the key properties of 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium?
4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium has a molecular weight of 198.03 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,2-dihydroimidazol-2-ide;rhodium is sourced from PubChem (CID 156809665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).