C24H25ClN2S — CID 156810127
6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2,6-dimethyl-3-phenylpyridine (PubChem CID 156810127) has the molecular formula C24H25ClN2S and a molecular weight of 409.00 g/mol. Its IUPAC name is 6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2,6-dimethyl-3-phenylpyridine.
| Compound Name | 6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2,6-dimethyl-3-phenylpyridine |
|---|---|
| PubChem CID | 156810127 |
| Molecular Formula | C24H25ClN2S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 6-buta-1,3-dien-2-yl-2-chloro-5,7-dihydro-4H-thieno[2,3-c]pyridine;2,6-dimethyl-3-phenylpyridine |
| SMILES | C=CC(=C)N1CCc2cc(Cl)sc2C1.Cc1ccc(-c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C13H13N.C11H12ClNS/c1-10-8-9-13(11(2)14-10)12-6-4-3-5-7-12;1-3-8(2)13-5-4-9-6-11(12)14-10(9)7-13/h3-9H,1-2H3;3,6H,1-2,4-5,7H2 |
| InChIKey | WMJIHBNUWNSJEB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|