C15H26O3 — CID 15681089
ethyl 2-(2-hydroxypropan-2-yl)-5-methylnona-3,4-dienoate (PubChem CID 15681089) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is ethyl 2-(2-hydroxypropan-2-yl)-5-methylnona-3,4-dienoate.
| Compound Name | ethyl 2-(2-hydroxypropan-2-yl)-5-methylnona-3,4-dienoate |
|---|---|
| PubChem CID | 15681089 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethyl 2-(2-hydroxypropan-2-yl)-5-methylnona-3,4-dienoate |
| SMILES | CCCCC(C)=C=CC(C(=O)OCC)C(C)(C)O |
| InChI | InChI=1S/C15H26O3/c1-6-8-9-12(3)10-11-13(15(4,5)17)14(16)18-7-2/h11,13,17H,6-9H2,1-5H3 |
| InChIKey | SDUDZDDLCQDAJY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |