C17H19NO4 — CID 15681095
benzyl (2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 15681095) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is benzyl (2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15681095 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | benzyl (2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC1=C[C@H]([C@H]2CCCN2C(=O)OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C17H19NO4/c1-12-10-15(22-16(12)19)14-8-5-9-18(14)17(20)21-11-13-6-3-2-4-7-13/h2-4,6-7,10,14-15H,5,8-9,11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | DMSPXOMMJLVUHO-HUUCEWRRSA-N |
| XLogP | 2.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |