C24H31F3 — CID 156811575
1,3-difluoro-2,5-dimethylbenzene;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene (PubChem CID 156811575) has the molecular formula C24H31F3 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1,3-difluoro-2,5-dimethylbenzene;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene.
| Compound Name | 1,3-difluoro-2,5-dimethylbenzene;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 156811575 |
| Molecular Formula | C24H31F3 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1,3-difluoro-2,5-dimethylbenzene;1,4-dimethylcyclohexene;2-fluoro-1,4-dimethylbenzene |
| SMILES | CC1=CCC(C)CC1.Cc1cc(F)c(C)c(F)c1.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H8F2.C8H9F.C8H14/c1-5-3-7(9)6(2)8(10)4-5;1-6-3-4-7(2)8(9)5-6;1-7-3-5-8(2)6-4-7/h3-4H,1-2H3;3-5H,1-2H3;3,8H,4-6H2,1-2H3 |
| InChIKey | RIBRIXNXCMPYNA-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|