About 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one
3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one (PubChem CID 156811843) has the molecular formula C18H32OSe
and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one.
Molecular Properties
| Compound Name | 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one |
| PubChem CID | 156811843 |
| Molecular Formula | C18H32OSe |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one |
| SMILES | CCCCC[Se]C(C)CC(=O)C1C(C)C=CCC1(C)C |
| InChI | InChI=1S/C18H32OSe/c1-6-7-8-12-20-15(3)13-16(19)17-14(2)10-9-11-18(17,4)5/h9-10,14-15,17H,6-8,11-13H2,1-5H3 |
| InChIKey | LICWAFNGAKREDH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one?
The IUPAC name of 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one (CID 156811843) is 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one.
What is the SMILES notation for 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one?
The canonical SMILES for 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one is CCCCC[Se]C(C)CC(=O)C1C(C)C=CCC1(C)C.
What is the InChIKey of 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one?
The InChIKey is LICWAFNGAKREDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32OSe/c1-6-7-8-12-20-15(3)13-16(19)17-14(2)10-9-11-18(17,4)5/h9-10,14-15,17H,6-8,11-13H2,1-5H3.
What are the key properties of 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one?
3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one has a molecular weight of 343.41 g/mol, XLogP of 5.31, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentylselanyl-1-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-1-one is sourced from PubChem (CID 156811843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).