C9H17NO2 — CID 15681246
(4R,8R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ol (PubChem CID 15681246) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (4R,8R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ol.
| Compound Name | (4R,8R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ol |
|---|---|
| PubChem CID | 15681246 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (4R,8R,9aS)-4-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ol |
| SMILES | C[C@@H]1COC[C@@H]2C[C@H](O)CCN21 |
| InChI | InChI=1S/C9H17NO2/c1-7-5-12-6-8-4-9(11)2-3-10(7)8/h7-9,11H,2-6H2,1H3/t7-,8+,9-/m1/s1 |
| InChIKey | XDONDDDHPOLBQH-HRDYMLBCSA-N |
| XLogP | 0.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |