C22H22 — CID 156812497
(2E,3Z)-2,3-di(ethylidene)spiro[cyclohexane-1,9'-fluorene] (PubChem CID 156812497) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)spiro[cyclohexane-1,9'-fluorene].
| Compound Name | (2E,3Z)-2,3-di(ethylidene)spiro[cyclohexane-1,9'-fluorene] |
|---|---|
| PubChem CID | 156812497 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)spiro[cyclohexane-1,9'-fluorene] |
| SMILES | C/C=C1/CCCC2(/C1=C/C)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C22H22/c1-3-16-10-9-15-22(19(16)4-2)20-13-7-5-11-17(20)18-12-6-8-14-21(18)22/h3-8,11-14H,9-10,15H2,1-2H3/b16-3-,19-4+ |
| InChIKey | FLXICAFVWUTUHN-KRZGJESGSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |