C25H28N2O5 — CID 156812711
2-[3-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]iminomethyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid (PubChem CID 156812711) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[3-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]iminomethyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid.
| Compound Name | 2-[3-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]iminomethyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid |
|---|---|
| PubChem CID | 156812711 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[3-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]iminomethyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]acetic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)/N=C/C1CCc2ccccc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C25H28N2O5/c1-2-32-25(31)21(15-12-18-8-4-3-5-9-18)26-16-20-14-13-19-10-6-7-11-22(19)27(24(20)30)17-23(28)29/h3-11,16,20-21H,2,12-15,17H2,1H3,(H,28,29)/b26-16+/t20?,21-/m0/s1 |
| InChIKey | WZZJOFSXBHOKTI-LAZHXEQWSA-N |
| XLogP | 3.30 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|