About N,N-dimethylpropan-1-amine;oxolane
N,N-dimethylpropan-1-amine;oxolane (PubChem CID 156812938) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;oxolane.
Molecular Properties
| Compound Name | N,N-dimethylpropan-1-amine;oxolane |
| PubChem CID | 156812938 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | N,N-dimethylpropan-1-amine;oxolane |
| SMILES | C1CCOC1.CCCN(C)C |
| InChI | InChI=1S/C5H13N.C4H8O/c1-4-5-6(2)3;1-2-4-5-3-1/h4-5H2,1-3H3;1-4H2 |
| InChIKey | LLPDISZVJTUCNS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylpropan-1-amine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpropan-1-amine;oxolane?
The IUPAC name of N,N-dimethylpropan-1-amine;oxolane (CID 156812938) is N,N-dimethylpropan-1-amine;oxolane.
What is the SMILES notation for N,N-dimethylpropan-1-amine;oxolane?
The canonical SMILES for N,N-dimethylpropan-1-amine;oxolane is C1CCOC1.CCCN(C)C.
What is the InChIKey of N,N-dimethylpropan-1-amine;oxolane?
The InChIKey is LLPDISZVJTUCNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C4H8O/c1-4-5-6(2)3;1-2-4-5-3-1/h4-5H2,1-3H3;1-4H2.
What are the key properties of N,N-dimethylpropan-1-amine;oxolane?
N,N-dimethylpropan-1-amine;oxolane has a molecular weight of 159.27 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpropan-1-amine;oxolane is sourced from PubChem (CID 156812938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).