C22H31N7O — CID 156813302
7-N-butyl-1-[(2-methoxy-4-piperidin-4-ylphenyl)methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 156813302) has the molecular formula C22H31N7O and a molecular weight of 409.54 g/mol. Its IUPAC name is 7-N-butyl-1-[(2-methoxy-4-piperidin-4-ylphenyl)methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-1-[(2-methoxy-4-piperidin-4-ylphenyl)methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 156813302 |
| Molecular Formula | C22H31N7O |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 7-N-butyl-1-[(2-methoxy-4-piperidin-4-ylphenyl)methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ccc(C4CCNCC4)cc3OC)c12 |
| InChI | InChI=1S/C22H31N7O/c1-3-4-9-25-21-20-18(27-22(23)28-21)13-26-29(20)14-17-6-5-16(12-19(17)30-2)15-7-10-24-11-8-15/h5-6,12-13,15,24H,3-4,7-11,14H2,1-2H3,(H3,23,25,27,28) |
| InChIKey | UAAJSGJPVLEYEG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|