C35H29ClF2N2O5 — CID 156813749
2-[[4-(2'-chlorospiro[1,3-benzodioxole-2,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-4-yl)-2,6-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid (PubChem CID 156813749) has the molecular formula C35H29ClF2N2O5 and a molecular weight of 631.08 g/mol. Its IUPAC name is 2-[[4-(2'-chlorospiro[1,3-benzodioxole-2,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-4-yl)-2,6-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-[[4-(2'-chlorospiro[1,3-benzodioxole-2,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-4-yl)-2,6-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 156813749 |
| Molecular Formula | C35H29ClF2N2O5 |
| Molecular Weight | 631.08 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | 2-[[4-(2'-chlorospiro[1,3-benzodioxole-2,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-4-yl)-2,6-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
| SMILES | COCCn1c(Cc2c(F)cc(-c3cccc4c3OC3(CCCCc5cc(Cl)ccc53)O4)cc2F)nc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C35H29ClF2N2O5/c1-43-14-13-40-30-18-21(34(41)42)8-11-29(30)39-32(40)19-25-27(37)16-22(17-28(25)38)24-6-4-7-31-33(24)45-35(44-31)12-3-2-5-20-15-23(36)9-10-26(20)35/h4,6-11,15-18H,2-3,5,12-14,19H2,1H3,(H,41,42) |
| InChIKey | WBASYLXDTVXYER-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.08 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |