C23H22ClFN2O3 — CID 156814339
(R)-(2-chlorophenyl)-[4-[(3S)-3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]methanol (PubChem CID 156814339) has the molecular formula C23H22ClFN2O3 and a molecular weight of 428.89 g/mol. Its IUPAC name is (R)-(2-chlorophenyl)-[4-[(3S)-3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]methanol.
| Compound Name | (R)-(2-chlorophenyl)-[4-[(3S)-3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 156814339 |
| Molecular Formula | C23H22ClFN2O3 |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (R)-(2-chlorophenyl)-[4-[(3S)-3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]methanol |
| SMILES | OCc1cc([C@@H](O)c2ccccc2Cl)ccc1N1CC[C@H](Oc2ncccc2F)C1 |
| InChI | InChI=1S/C23H22ClFN2O3/c24-19-5-2-1-4-18(19)22(29)15-7-8-21(16(12-15)14-28)27-11-9-17(13-27)30-23-20(25)6-3-10-26-23/h1-8,10,12,17,22,28-29H,9,11,13-14H2/t17-,22+/m0/s1 |
| InChIKey | DXMAIYLAZZLEKW-HTAPYJJXSA-N |
| XLogP | 4.11 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|