C24H20F2N2O3 — CID 156814341
2-[5-(4-fluorobenzoyl)-2-[3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]acetaldehyde (PubChem CID 156814341) has the molecular formula C24H20F2N2O3 and a molecular weight of 422.43 g/mol. Its IUPAC name is 2-[5-(4-fluorobenzoyl)-2-[3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]acetaldehyde.
| Compound Name | 2-[5-(4-fluorobenzoyl)-2-[3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 156814341 |
| Molecular Formula | C24H20F2N2O3 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[5-(4-fluorobenzoyl)-2-[3-[(3-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]acetaldehyde |
| SMILES | O=CCc1cc(C(=O)c2ccc(F)cc2)ccc1N1CCC(Oc2ncccc2F)C1 |
| InChI | InChI=1S/C24H20F2N2O3/c25-19-6-3-16(4-7-19)23(30)18-5-8-22(17(14-18)10-13-29)28-12-9-20(15-28)31-24-21(26)2-1-11-27-24/h1-8,11,13-14,20H,9-10,12,15H2 |
| InChIKey | LBQVBPDCZDPEIH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|