C24H28ClN3O3 — CID 156814477
2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-[(2E,4Z)-4-ethylhexa-2,4-dien-3-yl]oxybenzamide (PubChem CID 156814477) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-[(2E,4Z)-4-ethylhexa-2,4-dien-3-yl]oxybenzamide.
| Compound Name | 2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-[(2E,4Z)-4-ethylhexa-2,4-dien-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 156814477 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-[(2E,4Z)-4-ethylhexa-2,4-dien-3-yl]oxybenzamide |
| SMILES | C/C=C(CC)\C(=C/C)Oc1ccc(N2CC[C@H](Oc3ncccc3Cl)C2)c(C(N)=O)c1 |
| InChI | InChI=1S/C24H28ClN3O3/c1-4-16(5-2)22(6-3)30-17-9-10-21(19(14-17)23(26)29)28-13-11-18(15-28)31-24-20(25)8-7-12-27-24/h4,6-10,12,14,18H,5,11,13,15H2,1-3H3,(H2,26,29)/b16-4-,22-6+/t18-/m0/s1 |
| InChIKey | MMZRGRYBCCPNER-LDCJECRGSA-N |
| XLogP | 5.13 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|