C24H27F3N2O3 — CID 156814518
[4-[4-[(3S)-3-[(1E,3E)-1-amino-5,5,5-trifluoro-4-methylpenta-1,3-dienoxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]phenyl]methanol (PubChem CID 156814518) has the molecular formula C24H27F3N2O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is [4-[4-[(3S)-3-[(1E,3E)-1-amino-5,5,5-trifluoro-4-methylpenta-1,3-dienoxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]phenyl]methanol.
| Compound Name | [4-[4-[(3S)-3-[(1E,3E)-1-amino-5,5,5-trifluoro-4-methylpenta-1,3-dienoxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 156814518 |
| Molecular Formula | C24H27F3N2O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [4-[4-[(3S)-3-[(1E,3E)-1-amino-5,5,5-trifluoro-4-methylpenta-1,3-dienoxy]pyrrolidin-1-yl]-3-(hydroxymethyl)phenyl]phenyl]methanol |
| SMILES | C/C(=C\C=C(/N)O[C@H]1CCN(c2ccc(-c3ccc(CO)cc3)cc2CO)C1)C(F)(F)F |
| InChI | InChI=1S/C24H27F3N2O3/c1-16(24(25,26)27)2-9-23(28)32-21-10-11-29(13-21)22-8-7-19(12-20(22)15-31)18-5-3-17(14-30)4-6-18/h2-9,12,21,30-31H,10-11,13-15,28H2,1H3/b16-2+,23-9+/t21-/m0/s1 |
| InChIKey | IHHHPGFYFISRSD-XJEKNGMDSA-N |
| XLogP | 4.24 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|