About cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole
cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole (PubChem CID 156815876) has the molecular formula C24H21F3N2O3
and a molecular weight of 442.44 g/mol. Its IUPAC name is cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
Molecular Properties
| Compound Name | cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| PubChem CID | 156815876 |
| Molecular Formula | C24H21F3N2O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| SMILES | Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1.O=C(NCc1ccco1)OC1CCC1 |
| InChI | InChI=1S/C14H8F3N.C10H13NO3/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;12-10(14-8-3-1-4-8)11-7-9-5-2-6-13-9/h1-7,18H;2,5-6,8H,1,3-4,7H2,(H,11,12) |
| InChIKey | DHHKQEXRKQQNIE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The IUPAC name of cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole (CID 156815876) is cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
What is the SMILES notation for cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The canonical SMILES for cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole is Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1.O=C(NCc1ccco1)OC1CCC1.
What is the InChIKey of cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The InChIKey is DHHKQEXRKQQNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F3N.C10H13NO3/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;12-10(14-8-3-1-4-8)11-7-9-5-2-6-13-9/h1-7,18H;2,5-6,8H,1,3-4,7H2,(H,11,12).
What are the key properties of cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole has a molecular weight of 442.44 g/mol, XLogP of 6.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl N-(furan-2-ylmethyl)carbamate;5,7-difluoro-2-(4-fluorophenyl)-1H-indole is sourced from PubChem (CID 156815876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).