About 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide
2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide (PubChem CID 156815991) has the molecular formula C20H18F3N3O
and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide |
| PubChem CID | 156815991 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide |
| SMILES | NC(=O)CNC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1 |
| InChI | InChI=1S/C20H18F3N3O/c21-12-3-1-10(2-4-12)19-18(11-5-14(6-11)25-9-17(24)27)15-7-13(22)8-16(23)20(15)26-19/h1-4,7-8,11,14,25-26H,5-6,9H2,(H2,24,27) |
| InChIKey | FEBVZGUNNWWLPO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide?
The IUPAC name of 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide (CID 156815991) is 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide.
What is the SMILES notation for 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide?
The canonical SMILES for 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide is NC(=O)CNC1CC(c2c(-c3ccc(F)cc3)[nH]c3c(F)cc(F)cc23)C1.
What is the InChIKey of 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide?
The InChIKey is FEBVZGUNNWWLPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F3N3O/c21-12-3-1-10(2-4-12)19-18(11-5-14(6-11)25-9-17(24)27)15-7-13(22)8-16(23)20(15)26-19/h1-4,7-8,11,14,25-26H,5-6,9H2,(H2,24,27).
What are the key properties of 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide?
2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide has a molecular weight of 373.38 g/mol, XLogP of 3.57, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]cyclobutyl]amino]acetamide is sourced from PubChem (CID 156815991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).