About 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane
5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane (PubChem CID 156816458) has the molecular formula C19H18F3N
and a molecular weight of 317.35 g/mol. Its IUPAC name is 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane.
Molecular Properties
| Compound Name | 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane |
| PubChem CID | 156816458 |
| Molecular Formula | C19H18F3N |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane |
| SMILES | CC1CCC1.Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1 |
| InChI | InChI=1S/C14H8F3N.C5H10/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;1-5-3-2-4-5/h1-7,18H;5H,2-4H2,1H3 |
| InChIKey | OXISJUNQASWFGB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane?
The IUPAC name of 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane (CID 156816458) is 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane.
What is the SMILES notation for 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane?
The canonical SMILES for 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane is CC1CCC1.Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1.
What is the InChIKey of 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane?
The InChIKey is OXISJUNQASWFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F3N.C5H10/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;1-5-3-2-4-5/h1-7,18H;5H,2-4H2,1H3.
What are the key properties of 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane?
5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane has a molecular weight of 317.35 g/mol, XLogP of 6.06, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-(4-fluorophenyl)-1H-indole;methylcyclobutane is sourced from PubChem (CID 156816458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).