C22H28N6S — CID 156817047
ethane;5-[3-[[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]sulfanylamino]methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156817047) has the molecular formula C22H28N6S and a molecular weight of 408.58 g/mol. Its IUPAC name is ethane;5-[3-[[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]sulfanylamino]methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | ethane;5-[3-[[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]sulfanylamino]methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156817047 |
| Molecular Formula | C22H28N6S |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | ethane;5-[3-[[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]sulfanylamino]methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=C/C(=C\C=C/C)NSNCc1cccc(-c2c[nH]c3ncnc(N)c23)c1.CC |
| InChI | InChI=1S/C20H22N6S.C2H6/c1-3-5-9-16(4-2)26-27-25-11-14-7-6-8-15(10-14)17-12-22-20-18(17)19(21)23-13-24-20;1-2/h3-10,12-13,25-26H,2,11H2,1H3,(H3,21,22,23,24);1-2H3/b5-3-,16-9+; |
| InChIKey | FDWGJJREVOEOOV-GNNNDAFXSA-N |
| XLogP | 5.12 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|