C21H19FN5O4PS — CID 156817108
3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(dimethoxyphosphanylmethylsulfinyl)phenyl]pyrazine-2-carboxamide (PubChem CID 156817108) has the molecular formula C21H19FN5O4PS and a molecular weight of 487.45 g/mol. Its IUPAC name is 3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(dimethoxyphosphanylmethylsulfinyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(dimethoxyphosphanylmethylsulfinyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156817108 |
| Molecular Formula | C21H19FN5O4PS |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(dimethoxyphosphanylmethylsulfinyl)phenyl]pyrazine-2-carboxamide |
| SMILES | COP(CS(=O)c1ccc(NC(=O)c2nc(-c3cc(F)ccc3C#N)cnc2N)cc1)OC |
| InChI | InChI=1S/C21H19FN5O4PS/c1-30-32(31-2)12-33(29)16-7-5-15(6-8-16)26-21(28)19-20(24)25-11-18(27-19)17-9-14(22)4-3-13(17)10-23/h3-9,11H,12H2,1-2H3,(H2,24,25)(H,26,28) |
| InChIKey | KLYMTCHXCQDVNZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|