C17H16N6O2S — CID 156817180
3-amino-6-(4-methylphenyl)-N-(6-sulfinamoyl-3-pyridinyl)pyrazine-2-carboxamide (PubChem CID 156817180) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is 3-amino-6-(4-methylphenyl)-N-(6-sulfinamoyl-3-pyridinyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(4-methylphenyl)-N-(6-sulfinamoyl-3-pyridinyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156817180 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-amino-6-(4-methylphenyl)-N-(6-sulfinamoyl-3-pyridinyl)pyrazine-2-carboxamide |
| SMILES | Cc1ccc(-c2cnc(N)c(C(=O)Nc3ccc(S(N)=O)nc3)n2)cc1 |
| InChI | InChI=1S/C17H16N6O2S/c1-10-2-4-11(5-3-10)13-9-21-16(18)15(23-13)17(24)22-12-6-7-14(20-8-12)26(19)25/h2-9H,19H2,1H3,(H2,18,21)(H,22,24) |
| InChIKey | BCQSCJSKAUYOKK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 136.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |