C21H22FN4O6PS — CID 156817243
3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(5-fluoro-2-methylphenyl)pyrazine-2-carboxamide (PubChem CID 156817243) has the molecular formula C21H22FN4O6PS and a molecular weight of 508.47 g/mol. Its IUPAC name is 3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(5-fluoro-2-methylphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(5-fluoro-2-methylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156817243 |
| Molecular Formula | C21H22FN4O6PS |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(5-fluoro-2-methylphenyl)pyrazine-2-carboxamide |
| SMILES | COP(=O)(CS(=O)(=O)c1ccc(NC(=O)c2nc(-c3cc(F)ccc3C)cnc2N)cc1)OC |
| InChI | InChI=1S/C21H22FN4O6PS/c1-13-4-5-14(22)10-17(13)18-11-24-20(23)19(26-18)21(27)25-15-6-8-16(9-7-15)34(29,30)12-33(28,31-2)32-3/h4-11H,12H2,1-3H3,(H2,23,24)(H,25,27) |
| InChIKey | GPMQJMQGGUZPHL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|