C23H23FN5O3PS — CID 156817244
3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(diethoxyphosphanylmethylsulfanyl)phenyl]pyrazine-2-carboxamide (PubChem CID 156817244) has the molecular formula C23H23FN5O3PS and a molecular weight of 499.51 g/mol. Its IUPAC name is 3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(diethoxyphosphanylmethylsulfanyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(diethoxyphosphanylmethylsulfanyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156817244 |
| Molecular Formula | C23H23FN5O3PS |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-amino-6-(2-cyano-5-fluorophenyl)-N-[4-(diethoxyphosphanylmethylsulfanyl)phenyl]pyrazine-2-carboxamide |
| SMILES | CCOP(CSc1ccc(NC(=O)c2nc(-c3cc(F)ccc3C#N)cnc2N)cc1)OCC |
| InChI | InChI=1S/C23H23FN5O3PS/c1-3-31-33(32-4-2)14-34-18-9-7-17(8-10-18)28-23(30)21-22(26)27-13-20(29-21)19-11-16(24)6-5-15(19)12-25/h5-11,13H,3-4,14H2,1-2H3,(H2,26,27)(H,28,30) |
| InChIKey | ONLPHXOIRFMGGL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|