C23H26F3N5O2 — CID 156817919
2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;2,3-dimethoxy-5-(trifluoromethyl)pyridine (PubChem CID 156817919) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;2,3-dimethoxy-5-(trifluoromethyl)pyridine.
| Compound Name | 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;2,3-dimethoxy-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 156817919 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-(3-azabicyclo[3.1.0]hexan-3-ylmethyl)-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;2,3-dimethoxy-5-(trifluoromethyl)pyridine |
| SMILES | COc1cc(C(F)(F)F)cnc1OC.c1cc2c3c(n1)nc(CN1CC4CC4C1)n3CCC2 |
| InChI | InChI=1S/C15H18N4.C8H8F3NO2/c1-2-10-3-4-16-15-14(10)19(5-1)13(17-15)9-18-7-11-6-12(11)8-18;1-13-6-3-5(8(9,10)11)4-12-7(6)14-2/h3-4,11-12H,1-2,5-9H2;3-4H,1-2H3 |
| InChIKey | RRIGOBRWCDQFQK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |