C29H30F3NO5 — CID 156818388
N-[(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 156818388) has the molecular formula C29H30F3NO5 and a molecular weight of 529.56 g/mol. Its IUPAC name is N-[(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 156818388 |
| Molecular Formula | C29H30F3NO5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N-[(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@H]1CO[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H30F3NO5/c30-29(31,32)28(34)33-24-19-36-25(20-35-16-21-10-4-1-5-11-21)27(38-18-23-14-8-3-9-15-23)26(24)37-17-22-12-6-2-7-13-22/h1-15,24-27H,16-20H2,(H,33,34)/t24-,25+,26+,27-/m0/s1 |
| InChIKey | SBNMJWTZMDETET-YAOOYPAMSA-N |
| XLogP | 4.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |