About (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine
(Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine (PubChem CID 156818494) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine |
| PubChem CID | 156818494 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine |
| SMILES | CCC(C)C/C(N)=C/NCN(C)C(C)C |
| InChI | InChI=1S/C12H27N3/c1-6-11(4)7-12(13)8-14-9-15(5)10(2)3/h8,10-11,14H,6-7,9,13H2,1-5H3/b12-8- |
| InChIKey | CGUULAAOBARKMR-WQLSENKSSA-N |
| XLogP | 2.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine?
The IUPAC name of (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine (CID 156818494) is (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine?
The canonical SMILES for (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine is CCC(C)C/C(N)=C/NCN(C)C(C)C.
What is the InChIKey of (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine?
The InChIKey is CGUULAAOBARKMR-WQLSENKSSA-N. The full InChI is InChI=1S/C12H27N3/c1-6-11(4)7-12(13)8-14-9-15(5)10(2)3/h8,10-11,14H,6-7,9,13H2,1-5H3/b12-8-.
What are the key properties of (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine?
(Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine has a molecular weight of 213.37 g/mol, XLogP of 2.11, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-methyl-1-N-[[methyl(propan-2-yl)amino]methyl]hex-1-ene-1,2-diamine is sourced from PubChem (CID 156818494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).