About CID 156818597
CID 156818597 (PubChem CID 156818597) has the molecular formula C12H16B2FNO
and a molecular weight of 230.89 g/mol.
Molecular Properties
| Compound Name | CID 156818597 |
| PubChem CID | 156818597 |
| Molecular Formula | C12H16B2FNO |
| Molecular Weight | 230.89 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | — |
| SMILES | CC.[B]C1([B])OCc2ncc(C)cc2C1(C)F |
| InChI | InChI=1S/C10H10B2FNO.C2H6/c1-6-3-7-8(14-4-6)5-15-10(11,12)9(7,2)13;1-2/h3-4H,5H2,1-2H3;1-2H3 |
| InChIKey | CEBASEABLAZOAT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156818597 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156818597?
The IUPAC name of CID 156818597 (CID 156818597) is not available.
What is the SMILES notation for CID 156818597?
The canonical SMILES for CID 156818597 is CC.[B]C1([B])OCc2ncc(C)cc2C1(C)F.
What is the InChIKey of CID 156818597?
The InChIKey is CEBASEABLAZOAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10B2FNO.C2H6/c1-6-3-7-8(14-4-6)5-15-10(11,12)9(7,2)13;1-2/h3-4H,5H2,1-2H3;1-2H3.
What are the key properties of CID 156818597?
CID 156818597 has a molecular weight of 230.89 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156818597 is sourced from PubChem (CID 156818597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).