C17H25NO — CID 156818680
(2Z,3E,5Z)-4-(cyclohexa-1,5-dien-1-ylmethoxy)-2-propylidenehepta-3,5-dien-1-amine (PubChem CID 156818680) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (2Z,3E,5Z)-4-(cyclohexa-1,5-dien-1-ylmethoxy)-2-propylidenehepta-3,5-dien-1-amine.
| Compound Name | (2Z,3E,5Z)-4-(cyclohexa-1,5-dien-1-ylmethoxy)-2-propylidenehepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 156818680 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2Z,3E,5Z)-4-(cyclohexa-1,5-dien-1-ylmethoxy)-2-propylidenehepta-3,5-dien-1-amine |
| SMILES | C/C=C\C(=C/C(=C/CC)CN)OCC1=CCCC=C1 |
| InChI | InChI=1S/C17H25NO/c1-3-8-16(13-18)12-17(9-4-2)19-14-15-10-6-5-7-11-15/h4,6,8-12H,3,5,7,13-14,18H2,1-2H3/b9-4-,16-8-,17-12+ |
| InChIKey | ZEBPEQBZQSXCLU-VZOKBWMASA-N |
| XLogP | 4.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|