About (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane
(4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane (PubChem CID 156818757) has the molecular formula C12H15Cl2N
and a molecular weight of 244.16 g/mol. Its IUPAC name is (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane.
Molecular Properties
| Compound Name | (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane |
| PubChem CID | 156818757 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane |
| SMILES | C=C(Cl)/C=c1/cc(Cl)nc/c1=C/C.CC |
| InChI | InChI=1S/C10H9Cl2N.C2H6/c1-3-8-6-13-10(12)5-9(8)4-7(2)11;1-2/h3-6H,2H2,1H3;1-2H3/b8-3-,9-4-; |
| InChIKey | VQPGHCGKOPOMNW-FLHNYSSYSA-N |
| XLogP | 3.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane?
The IUPAC name of (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane (CID 156818757) is (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane.
What is the SMILES notation for (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane?
The canonical SMILES for (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane is C=C(Cl)/C=c1/cc(Cl)nc/c1=C/C.CC.
What is the InChIKey of (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane?
The InChIKey is VQPGHCGKOPOMNW-FLHNYSSYSA-N. The full InChI is InChI=1S/C10H9Cl2N.C2H6/c1-3-8-6-13-10(12)5-9(8)4-7(2)11;1-2/h3-6H,2H2,1H3;1-2H3/b8-3-,9-4-;.
What are the key properties of (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane?
(4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane has a molecular weight of 244.16 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5E)-2-chloro-4-(2-chloroprop-2-enylidene)-5-ethylidenepyridine;ethane is sourced from PubChem (CID 156818757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).