About CID 156819180
CID 156819180 (PubChem CID 156819180) has the molecular formula C29H28FIN5O3-
and a molecular weight of 640.48 g/mol.
Molecular Properties
| Compound Name | CID 156819180 |
| PubChem CID | 156819180 |
| Molecular Formula | C29H28FIN5O3- |
| Molecular Weight | 640.48 g/mol |
| Exact Mass | 640.12 |
| IUPAC Name | — |
| SMILES | C[C@@]1(F)COCc2ccc(C(=O)NCC3=C[I-]C=c4ccc(-c5ccnc(N6CCOCC6)n5)nc4=C3)cc21 |
| InChI | InChI=1S/C29H28FIN5O3/c1-29(30)18-39-17-22-3-2-20(13-23(22)29)27(37)33-16-19-12-26-21(15-31-14-19)4-5-24(34-26)25-6-7-32-28(35-25)36-8-10-38-11-9-36/h2-7,12-15H,8-11,16-18H2,1H3,(H,33,37)/q-1/t29-/m1/s1 |
| InChIKey | FHISQWGXCVOEEQ-GDLZYMKVSA-N |
| XLogP | -0.97 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 640.48 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 156819180 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156819180?
The IUPAC name of CID 156819180 (CID 156819180) is not available.
What is the SMILES notation for CID 156819180?
The canonical SMILES for CID 156819180 is C[C@@]1(F)COCc2ccc(C(=O)NCC3=C[I-]C=c4ccc(-c5ccnc(N6CCOCC6)n5)nc4=C3)cc21.
What is the InChIKey of CID 156819180?
The InChIKey is FHISQWGXCVOEEQ-GDLZYMKVSA-N. The full InChI is InChI=1S/C29H28FIN5O3/c1-29(30)18-39-17-22-3-2-20(13-23(22)29)27(37)33-16-19-12-26-21(15-31-14-19)4-5-24(34-26)25-6-7-32-28(35-25)36-8-10-38-11-9-36/h2-7,12-15H,8-11,16-18H2,1H3,(H,33,37)/q-1/t29-/m1/s1.
What are the key properties of CID 156819180?
CID 156819180 has a molecular weight of 640.48 g/mol, XLogP of -0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156819180 is sourced from PubChem (CID 156819180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).