C27H41NO2 — CID 156819263
ethane;2-[(Z)-5-ethyl-8-methyl-2-methylidene-4-[(Z)-prop-1-enyl]dec-3-enyl]-4,5-dihydroisoindole-1,3-dione (PubChem CID 156819263) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is ethane;2-[(Z)-5-ethyl-8-methyl-2-methylidene-4-[(Z)-prop-1-enyl]dec-3-enyl]-4,5-dihydroisoindole-1,3-dione.
| Compound Name | ethane;2-[(Z)-5-ethyl-8-methyl-2-methylidene-4-[(Z)-prop-1-enyl]dec-3-enyl]-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 156819263 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | ethane;2-[(Z)-5-ethyl-8-methyl-2-methylidene-4-[(Z)-prop-1-enyl]dec-3-enyl]-4,5-dihydroisoindole-1,3-dione |
| SMILES | C=C(/C=C(\C=C/C)C(CC)CCC(C)CC)CN1C(=O)C2=C(CCC=C2)C1=O.CC |
| InChI | InChI=1S/C25H35NO2.C2H6/c1-6-11-21(20(8-3)15-14-18(4)7-2)16-19(5)17-26-24(27)22-12-9-10-13-23(22)25(26)28;1-2/h6,9,11-12,16,18,20H,5,7-8,10,13-15,17H2,1-4H3;1-2H3/b11-6-,21-16+; |
| InChIKey | XYDZKQRKJAVBIV-MEUVKNRTSA-N |
| XLogP | 6.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|