C28H25FN4O3 — CID 156819298
(4R)-4-cyano-N-[[2-[(3Z,5Z)-5-fluoro-6-methoxyhepta-1,3,5-trien-4-yl]-1,6-naphthyridin-7-yl]methyl]-3,4-dihydro-1H-isochromene-6-carboxamide (PubChem CID 156819298) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is (4R)-4-cyano-N-[[2-[(3Z,5Z)-5-fluoro-6-methoxyhepta-1,3,5-trien-4-yl]-1,6-naphthyridin-7-yl]methyl]-3,4-dihydro-1H-isochromene-6-carboxamide.
| Compound Name | (4R)-4-cyano-N-[[2-[(3Z,5Z)-5-fluoro-6-methoxyhepta-1,3,5-trien-4-yl]-1,6-naphthyridin-7-yl]methyl]-3,4-dihydro-1H-isochromene-6-carboxamide |
|---|---|
| PubChem CID | 156819298 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (4R)-4-cyano-N-[[2-[(3Z,5Z)-5-fluoro-6-methoxyhepta-1,3,5-trien-4-yl]-1,6-naphthyridin-7-yl]methyl]-3,4-dihydro-1H-isochromene-6-carboxamide |
| SMILES | C=C/C=C(C(\F)=C(/C)OC)/c1ccc2cnc(CNC(=O)c3ccc4c(c3)[C@H](C#N)COC4)cc2n1 |
| InChI | InChI=1S/C28H25FN4O3/c1-4-5-23(27(29)17(2)35-3)25-9-8-19-13-31-22(11-26(19)33-25)14-32-28(34)18-6-7-20-15-36-16-21(12-30)24(20)10-18/h4-11,13,21H,1,14-16H2,2-3H3,(H,32,34)/b23-5-,27-17-/t21-/m1/s1 |
| InChIKey | PZJQOTDYZMWTOQ-QLPSLRDZSA-N |
| XLogP | 5.11 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|