C28H29N7O2 — CID 156819302
N-[[2-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-1,6-naphthyridin-7-yl]methyl]-4,4-dimethyl-1,3-dihydroisochromene-6-carboxamide;formonitrile (PubChem CID 156819302) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is N-[[2-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-1,6-naphthyridin-7-yl]methyl]-4,4-dimethyl-1,3-dihydroisochromene-6-carboxamide;formonitrile.
| Compound Name | N-[[2-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-1,6-naphthyridin-7-yl]methyl]-4,4-dimethyl-1,3-dihydroisochromene-6-carboxamide;formonitrile |
|---|---|
| PubChem CID | 156819302 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-[[2-(6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-1,6-naphthyridin-7-yl]methyl]-4,4-dimethyl-1,3-dihydroisochromene-6-carboxamide;formonitrile |
| SMILES | C#N.CC1(C)COCc2ccc(C(=O)NCc3cc4nc(N5CCn6nccc6C5)ccc4cn3)cc21 |
| InChI | InChI=1S/C27H28N6O2.CHN/c1-27(2)17-35-16-20-4-3-18(11-23(20)27)26(34)29-14-21-12-24-19(13-28-21)5-6-25(31-24)32-9-10-33-22(15-32)7-8-30-33;1-2/h3-8,11-13H,9-10,14-17H2,1-2H3,(H,29,34);1H |
| InChIKey | QCKUCGQQHPPZIY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |