C10H12NO2Y- — CID 156819413
N-(2-methoxyethyl)benzamide;yttrium (PubChem CID 156819413) has the molecular formula C10H12NO2Y- and a molecular weight of 267.12 g/mol. Its IUPAC name is N-(2-methoxyethyl)benzamide;yttrium.
| Compound Name | N-(2-methoxyethyl)benzamide;yttrium |
|---|---|
| PubChem CID | 156819413 |
| Molecular Formula | C10H12NO2Y- |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | N-(2-methoxyethyl)benzamide;yttrium |
| SMILES | COCCNC(=O)c1c[c-]ccc1.[Y] |
| InChI | InChI=1S/C10H12NO2.Y/c1-13-8-7-11-10(12)9-5-3-2-4-6-9;/h2-3,5-6H,7-8H2,1H3,(H,11,12);/q-1; |
| InChIKey | HWGPSLCVUILBFT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|