C21H25N3O2 — CID 156819418
(3Z)-4-[3-hydroxy-3-(6-morpholin-4-yl-2-pyridinyl)cyclobutyl]-2-methylidenehepta-3,5-dienenitrile (PubChem CID 156819418) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3Z)-4-[3-hydroxy-3-(6-morpholin-4-yl-2-pyridinyl)cyclobutyl]-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3Z)-4-[3-hydroxy-3-(6-morpholin-4-yl-2-pyridinyl)cyclobutyl]-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 156819418 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (3Z)-4-[3-hydroxy-3-(6-morpholin-4-yl-2-pyridinyl)cyclobutyl]-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(\C=CC)C1CC(O)(c2cccc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-5-17(12-16(2)15-22)18-13-21(25,14-18)19-6-4-7-20(23-19)24-8-10-26-11-9-24/h3-7,12,18,25H,2,8-11,13-14H2,1H3/b5-3?,17-12+ |
| InChIKey | ONKINPOFXWJCNK-LGRLHCBPSA-N |
| XLogP | 3.10 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|