About 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen
4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen (PubChem CID 156820216) has the molecular formula C22H43NO3
and a molecular weight of 369.59 g/mol. Its IUPAC name is 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen |
| PubChem CID | 156820216 |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.32 |
| IUPAC Name | 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen |
| SMILES | CCC(C)COCC1CCC(C(=O)NCCCCCC(=O)C(C)C)CC1.[H][H] |
| InChI | InChI=1S/C22H41NO3.H2/c1-5-18(4)15-26-16-19-10-12-20(13-11-19)22(25)23-14-8-6-7-9-21(24)17(2)3;/h17-20H,5-16H2,1-4H3,(H,23,25);1H |
| InChIKey | YXBLXOAXTUUEGZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen?
The IUPAC name of 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen (CID 156820216) is 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen.
What is the SMILES notation for 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen?
The canonical SMILES for 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen is CCC(C)COCC1CCC(C(=O)NCCCCCC(=O)C(C)C)CC1.[H][H].
What is the InChIKey of 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen?
The InChIKey is YXBLXOAXTUUEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41NO3.H2/c1-5-18(4)15-26-16-19-10-12-20(13-11-19)22(25)23-14-8-6-7-9-21(24)17(2)3;/h17-20H,5-16H2,1-4H3,(H,23,25);1H.
What are the key properties of 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen?
4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen has a molecular weight of 369.59 g/mol, XLogP of 5.00, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylbutoxymethyl)-N-(7-methyl-6-oxooctyl)cyclohexane-1-carboxamide;molecular hydrogen is sourced from PubChem (CID 156820216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).