C23H27F3N6 — CID 156820890
4-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-N-[2-(3,4,5-trifluorophenyl)ethyl]quinazoline-2,4-diamine (PubChem CID 156820890) has the molecular formula C23H27F3N6 and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-N-[2-(3,4,5-trifluorophenyl)ethyl]quinazoline-2,4-diamine.
| Compound Name | 4-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-N-[2-(3,4,5-trifluorophenyl)ethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 156820890 |
| Molecular Formula | C23H27F3N6 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-N-[2-(3,4,5-trifluorophenyl)ethyl]quinazoline-2,4-diamine |
| SMILES | CN1CCN(CCNc2nc(NCCc3cc(F)c(F)c(F)c3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C23H27F3N6/c1-31-10-12-32(13-11-31)9-8-27-22-17-4-2-3-5-20(17)29-23(30-22)28-7-6-16-14-18(24)21(26)19(25)15-16/h2-5,14-15H,6-13H2,1H3,(H2,27,28,29,30) |
| InChIKey | ILXNTVPDRNHFSQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|