C32H48N2O2 — CID 156821041
[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 156821041) has the molecular formula C32H48N2O2 and a molecular weight of 492.75 g/mol. Its IUPAC name is [3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 156821041 |
| Molecular Formula | C32H48N2O2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | [3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1cccc2[nH]cc(C[C@H]3CCCN3C)c12 |
| InChI | InChI=1S/C32H48N2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-31(35)36-30-22-18-21-29-32(30)27(26-33-29)25-28-20-19-24-34(28)2/h7-8,10-11,18,21-22,26,28,33H,3-6,9,12-17,19-20,23-25H2,1-2H3/b8-7-,11-10-/t28-/m1/s1 |
| InChIKey | OONNUYHWSJZVPT-JCYLZPHTSA-N |
| XLogP | 8.52 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|