C12H11FN2O2 — CID 156821103
2-(4-fluoro-1H-indol-3-yl)-2-oxo-N,N-bis(trideuteriomethyl)acetamide (PubChem CID 156821103) has the molecular formula C12H11FN2O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-(4-fluoro-1H-indol-3-yl)-2-oxo-N,N-bis(trideuteriomethyl)acetamide.
| Compound Name | 2-(4-fluoro-1H-indol-3-yl)-2-oxo-N,N-bis(trideuteriomethyl)acetamide |
|---|---|
| PubChem CID | 156821103 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-(4-fluoro-1H-indol-3-yl)-2-oxo-N,N-bis(trideuteriomethyl)acetamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)C(=O)c1c[nH]c2cccc(F)c12)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H11FN2O2/c1-15(2)12(17)11(16)7-6-14-9-5-3-4-8(13)10(7)9/h3-6,14H,1-2H3/i1D3,2D3 |
| InChIKey | DRUIDRFDWYMWON-WFGJKAKNSA-N |
| XLogP | 1.58 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|