C36H37F3N2O6 — CID 156821704
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-5-(3,3-dimethyl-4-phenylmethoxybut-1-ynyl)-2-fluorophenyl]cyclopropane-1-carboxamide (PubChem CID 156821704) has the molecular formula C36H37F3N2O6 and a molecular weight of 650.69 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-5-(3,3-dimethyl-4-phenylmethoxybut-1-ynyl)-2-fluorophenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-5-(3,3-dimethyl-4-phenylmethoxybut-1-ynyl)-2-fluorophenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 156821704 |
| Molecular Formula | C36H37F3N2O6 |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]-5-(3,3-dimethyl-4-phenylmethoxybut-1-ynyl)-2-fluorophenyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C#Cc1cc(NC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)c(F)cc1NC[C@@H]1COC(C)(C)O1)COCc1ccccc1 |
| InChI | InChI=1S/C36H37F3N2O6/c1-33(2,22-43-20-23-8-6-5-7-9-23)13-12-24-16-29(27(37)18-28(24)40-19-26-21-44-34(3,4)45-26)41-32(42)35(14-15-35)25-10-11-30-31(17-25)47-36(38,39)46-30/h5-11,16-18,26,40H,14-15,19-22H2,1-4H3,(H,41,42)/t26-/m1/s1 |
| InChIKey | GGDWEILKFZNMEC-AREMUKBSSA-N |
| XLogP | 6.98 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|