C29H35F3N8O4S — CID 156822715
tert-butyl (3S)-3-[[8-ethyl-6-[4-(3,3,3-trifluoropropylsulfonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 156822715) has the molecular formula C29H35F3N8O4S and a molecular weight of 648.71 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[8-ethyl-6-[4-(3,3,3-trifluoropropylsulfonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[8-ethyl-6-[4-(3,3,3-trifluoropropylsulfonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156822715 |
| Molecular Formula | C29H35F3N8O4S |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | tert-butyl (3S)-3-[[8-ethyl-6-[4-(3,3,3-trifluoropropylsulfonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCc1cc(-c2ccc3c(NS(=O)(=O)CCC(F)(F)F)ncnn23)cc2cnc(N[C@H]3CCCN(C(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C29H35F3N8O4S/c1-5-18-13-19(22-8-9-23-25(34-17-35-40(22)23)38-45(42,43)12-10-29(30,31)32)14-20-15-33-26(37-24(18)20)36-21-7-6-11-39(16-21)27(41)44-28(2,3)4/h8-9,13-15,17,21H,5-7,10-12,16H2,1-4H3,(H,33,36,37)(H,34,35,38)/t21-/m0/s1 |
| InChIKey | GCCWQFNQDQWUOI-NRFANRHFSA-N |
| XLogP | 5.41 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |