C25H31N9S — CID 156822778
8-ethyl-N-piperidin-3-yl-6-[4-(pyrrolidin-1-ylsulfanylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-amine (PubChem CID 156822778) has the molecular formula C25H31N9S and a molecular weight of 489.65 g/mol. Its IUPAC name is 8-ethyl-N-piperidin-3-yl-6-[4-(pyrrolidin-1-ylsulfanylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-amine.
| Compound Name | 8-ethyl-N-piperidin-3-yl-6-[4-(pyrrolidin-1-ylsulfanylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 156822778 |
| Molecular Formula | C25H31N9S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 8-ethyl-N-piperidin-3-yl-6-[4-(pyrrolidin-1-ylsulfanylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]quinazolin-2-amine |
| SMILES | CCc1cc(-c2ccc3c(NSN4CCCC4)ncnn23)cc2cnc(NC3CCCNC3)nc12 |
| InChI | InChI=1S/C25H31N9S/c1-2-17-12-18(13-19-14-27-25(31-23(17)19)30-20-6-5-9-26-15-20)21-7-8-22-24(28-16-29-34(21)22)32-35-33-10-3-4-11-33/h7-8,12-14,16,20,26H,2-6,9-11,15H2,1H3,(H,27,30,31)(H,28,29,32) |
| InChIKey | DGDJEDSJAJINRW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|