C16H15ClF3N3O3 — CID 156822887
5-[3-[5-chloro-1-methyl-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 156822887) has the molecular formula C16H15ClF3N3O3 and a molecular weight of 389.76 g/mol. Its IUPAC name is 5-[3-[5-chloro-1-methyl-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-[5-chloro-1-methyl-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156822887 |
| Molecular Formula | C16H15ClF3N3O3 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-[3-[5-chloro-1-methyl-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | CC1c2cc(C(F)(F)F)c(Cl)cc2CN1C(=O)CCC1NC(=O)NC1=O |
| InChI | InChI=1S/C16H15ClF3N3O3/c1-7-9-5-10(16(18,19)20)11(17)4-8(9)6-23(7)13(24)3-2-12-14(25)22-15(26)21-12/h4-5,7,12H,2-3,6H2,1H3,(H2,21,22,25,26) |
| InChIKey | APELCBOXNMSIRZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|